Allosecurinine | Synonyms | Phyllochrysine |
| Appearance | Solid |
| CAS | 884-68-4 |
| Purity | 99.61% |
| Molecular Weight | 217.27 |
| Formula | C13H15NO2 |
| Color | Light yellow to yellow |
| SMILES | O=C(O1)C=C2[C@@]13[C@@](CCCC4)([H])N4[C@](C3)([H])C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15869 | Dihydroresveratrol 3-O-glucoside | Inquiry |
|
| PDP-13204 | 7,8-Dihydroxyflavone | Inquiry |
|
| PDP-17646 | Antioxidant Agent-10 | Inquiry |
|
| PDP-16984 | 5-OH-HxMF | Inquiry |
|
| PDP-16270 | Cantleyoside | Inquiry |
|
| PDP-19284 | Heteroclitin G | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
