Alpha-D-Fructofuranose | CAS No. | 10489-79-9 |
| Molecular Formula | C6H12O6 |
| MW | 180.16 |
| Boiling Point | 440.1±45.0ºC(lit.) |
| Synonyms | Lactulose impurity 12 |
| SMILES | C([CH]1[CH]([CH]([C](O1)(CO)O)O)O)O |
| InchiKey | RFSUNEUAIZKAJO-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5439 | D(-)-Ribose | Inquiry |
|
| OM-5647 | 6-Chloro-6-Deoxymannose | Inquiry |
|
| OM-5278 | Dextran T40 | Inquiry |
|
| OM-5567 | 2,3:4,5-Di-O-Isopropylidene-D-Arabinose | Inquiry |
|
| OM-5784 | 1,3,4,6-Tetra-O-Acetyl-2-Azido-2-Deoxy-Alpha-D-Galactopyranose | Inquiry |
|
| OM-5293 | Mannan | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
