Alpha-D-Ribofuranose 1-Acetate 2,3,5-Tribenzoate 
Catalog Number OM-5616
Product Name Alpha-D-Ribofuranose 1-Acetate 2,3,5-Tribenzoate
CAS No. 70832-64-3
| CAS No. | 70832-64-3 |
| Molecular Formula | C28H24O9 |
| MW | 504.485 |
| Boiling Point | 621ºC(lit.) |
| Application | Pharmaceutical synthesis intermediates. |
| Synonyms | 2-Acetoxy-5-((benzoyloxy)methyl)tetrahydrofuran-3,4-dibenzoic acid diester, clorabine impurity |
| SMILES | CC(=O)OC1C(C(C(O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
| InchiKey | GCZABPLTDYVJMP-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5403 | Tetraacetyl-L-Ribose | Inquiry |
|
| OM-5428 | D(+)-Arabitol | Inquiry |
|
| OM-5557 | Tri-O-Benzyl-D-Glucal | Inquiry |
|
| OM-5774 | D-Xylopyranose | Inquiry |
|
| OM-5654 | 2-Deoxy-2-Fluoro-D-Mannose | Inquiry |
|
| OM-5334 | 6-Deoxy-L-Talose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
