Alpha-L-Xylopyranose | CAS No. | 7296-58-4 |
| Molecular Formula | C5H10O5 |
| MW | 150.1299 |
| Boiling Point | 333.2±42.0ºC(Predicted) |
| MDL | MFCD09841838 |
| SMILES | C1[CH]([CH]([CH]([CH](O1)O)O)O)O |
| InchiKey | SRBFZHDQGSBBOR-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5749 | D-Glucofuranose | Inquiry |
|
| OM-5434 | D-Lactose Monohydrate | Inquiry |
|
| OM-5458 | L-Rhamnose | Inquiry |
|
| OM-5516 | Methyl-6-Azido-6-Deoxy-α-Dgalactopyranoside | Inquiry |
|
| OM-5734 | 2-Deoxy-L-Erythro-Pentofuranose | Inquiry |
|
| OM-5673 | L-Iditol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.