Altromycin A | CAS No. | 128439-47-4 |
| Molecular Weight | 911.94 |
| Formula | C46H57NO18 |
| SMILES | O[C@]([C@@H]1[C@@H](O)[C@H](OC)[C@H](O)[C@@H](C)O1)(C(OC)=O)C2=CC(C(C3=C4C(O)=C([C@H]5C[C@@](NC)(C)[C@H](O[C@@H]6C[C@H](OC)[C@H](O)[C@@H](C)O6)[C@H](C)O5)C=C3)=O)=C(C4=O)C(OC([C@](O7)(C)[C@@H]7C)=C8)=C2C8=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-10945 | NAD+ | Inquiry |
|
| MDP-23376 | DL-O-Phosphoserine (Standard) | Inquiry |
|
| MDP-23894 | Clavamycin A | Inquiry |
|
| MDP-12623 | Dihydroaltenuene B | Inquiry |
|
| MDP-10939 | Biotin | Inquiry |
|
| MDP-24327 | Matlystatin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
