Amauromine | CAS No. | 88360-87-6 |
| Molecular Weight | 508.65 |
| Formula | C32H36N4O2 |
| SMILES | C=CC(C)([C@]12[C@](NC3=CC=CC=C23)([H])N4[C@@](C(N5[C@](C[C@]6(C(C)(C)C=C)[C@@]5([H])NC7=CC=CC=C67)([H])C4=O)=O)([H])C1)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22552 | 7-Demethylnaphterpin | Inquiry |
|
| MDP-23066 | Ustusolate A | Inquiry |
|
| MDP-22750 | Cycloneroside B | Inquiry |
|
| MDP-11252 | Tubercidin | Inquiry |
|
| MDP-24013 | Pacidamycin 5 | Inquiry |
|
| MDP-24026 | Panclicin E | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
