Anemarsaponin E1 | CAS | 1276608-19-5 |
| Molecular Weight | 937.07 |
| Formula | C45H76O20 |
| SMILES | C[C@@]12[C@](C([C@@]3([H])[C@]2([H])[C@@H](C(O)(O3)CC[C@H](C)CO[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)C)O)([H])[C@@]5([H])[C@]([C@@]6([C@](C[C@H](CC6)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O)O)O[C@@H]8O[C@@H]([C@H]([C@@H]([C@H]8O)O)O)CO)([H])CC5)C)([H])CC1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18903 | Yadanziolide B | Inquiry |
|
| PDP-17654 | 11(α)-Hydroxynepasaikosaponin K | Inquiry |
|
| PDP-17069 | Minaxin C | Inquiry |
|
| PDP-19892 | Puerarin 6"-O-Xyloside (Standard) | Inquiry |
|
| PDP-18868 | Cepharanoline | Inquiry |
|
| PDP-18206 | Lophanthoidin E | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
