Angelol B | CAS | 83156-04-1 |
| Molecular Weight | 376.40 |
| Formula | C20H24O7 |
| SMILES | C/C=C(C)/C(O[C@@H]([C@H](O)C1=C(OC)C=C(O2)C(C=CC2=O)=C1)C(C)(O)C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13853 | Ophiopogonin D | Inquiry |
|
| PDP-18115 | Paeonilactone C | Inquiry |
|
| PDP-18576 | Betulinic Acid Methyl Ester | Inquiry |
|
| PDP-16748 | 9-Hydroxycamptothecin | Inquiry |
|
| PDP-17226 | Grosshemin | Inquiry |
|
| PDP-19165 | Caffeoyl-CoA | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
