Anisodamine | Synonyms | 6-Hydroxyhyoscyamine |
| Appearance | Solid |
| CAS | 55869-99-3 |
| Purity | 99.02% |
| Molecular Weight | 305.37 |
| Formula | C17H23NO4 |
| Color | White to off-white |
| SMILES | CN1[C@H]2[C@@H](O)C[C@@H]1C[C@H](OC([C@@H](C3=CC=CC=C3)CO)=O)C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17004 | Daturaolone | Inquiry |
|
| PDP-13297 | Betulin | Inquiry |
|
| PDP-18946 | Trijuganone C | Inquiry |
|
| PDP-17326 | Viroxocin | Inquiry |
|
| PDP-14991 | Liensinine Diperchlorate | Inquiry |
|
| PDP-15607 | Tenuifoliside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
