Anthracophyllone | CAS No. | 1801750-22-0 |
| Molecular Weight | 232.32 |
| Formula | C15H20O2 |
| SMILES | O=C(C=C12)[C@@]3([H])[C@@](C3(C)C)([H])[C@]2(C)[C@@H](C)CCC1=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23454 | Alliacol B | Inquiry |
|
| MDP-11053 | Erythromycin | Inquiry |
|
| MDP-23786 | Cyclooctatin | Inquiry |
|
| MDP-22395 | Mannose 6 Phosphate | Inquiry |
|
| MDP-22821 | Cochliodone A | Inquiry |
|
| MDP-23077 | Chitinovorin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
