Antibiotic A40104A | CAS No. | 69659-06-9 |
| Molecular Weight | 510.62 |
| Formula | C27H42O9 |
| SMILES | C[C@@H]1[C@]23[C@](C(CC3)=O)([H])[C@]([C@@H](C[C@](C)([C@H]1O)C=C)OC(CO[C@H]4[C@@H]([C@H]([C@@H](CO4)O)O)O)=O)([C@@H](CC2)C)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24185 | Nocardicyclin A | Inquiry |
|
| MDP-12743 | Mollicellin H | Inquiry |
|
| MDP-23529 | Menominin B | Inquiry |
|
| MDP-11023 | Fluconazole | Inquiry |
|
| MDP-21996 | Versipelostatin | Inquiry |
|
| MDP-11222 | Urethane | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
