Apigenin-7-glucuronide | Synonyms | Apigenin 7-O-glucuronide |
| Appearance | Solid |
| CAS | 29741-09-1 |
| Purity | 99.74% |
| Molecular Weight | 446.36 |
| Formula | C21H18O11 |
| Color | White to yellow |
| SMILES | O[C@H]([C@H]([C@@H]([C@@H](C(O)=O)O1)O)O)[C@@H]1OC2=CC(O)=C3C(C=C(C4=CC=C(O)C=C4)OC3=C2)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17928 | Ent-16α,17-dihydroxykauran-3-one | Inquiry |
|
| PDP-17594 | β-Obscurine | Inquiry |
|
| PDP-14393 | Heterophyllin B | Inquiry |
|
| PDP-14867 | Episappanol | Inquiry |
|
| PDP-20294 | trans-1,4-Dihydroxycyclohexaneacetic Acid | Inquiry |
|
| PDP-15192 | 2-(2-Phenylethyl)chromone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
