Apoatropine Hydrochloride | Appearance | Solid |
| CAS | 5978-81-4 |
| Purity | 99.62% |
| Molecular Weight | 307.82 |
| Formula | C17H22ClNO2 |
| Color | White to off-white |
| SMILES | C=C(C1=CC=CC=C1)C(O[C@H]2C[C@@H]3N(C)[C@@H](CC3)C2)=O.Cl |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light, stored under nitrogen The compound is unstable in solutions, freshly prepared is recommended. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20187 | Cyanidin 3-sambubioside (chloride) (Standard) | Inquiry |
|
| PDP-14398 | Glabrol | Inquiry |
|
| PDP-18648 | Abieta-8,11,13-triene-7α,15,18-triol | Inquiry |
|
| PDP-13249 | Yohimbine Hydrochloride | Inquiry |
|
| PDP-17553 | Aconicarchamine B | Inquiry |
|
| PDP-14780 | Rosarin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
