Argyrin F | CAS No. | 444300-74-7 |
| Molecular Weight | 840.90 |
| Formula | C40H44N10O9S |
| SMILES | COC1=C2C(C[C@@H]3NC([C@@H](NC(C4=CSC([C@H](NC(CN(C(C(NC([C@H](NC(CNC3=O)=O)C)=O)=C)=O)C)=O)CO)=N4)=O)CC5=CNC6=CC=CC=C56)=O)=CNC2=CC=C1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22544 | Boerelasin E | Inquiry |
|
| MDP-23454 | Alliacol B | Inquiry |
|
| MDP-11854 | L-2-Hydroxyglutaric Acid | Inquiry |
|
| MDP-12406 | Calcimycin Hemicalcium Salt | Inquiry |
|
| MDP-23498 | Agrobactin | Inquiry |
|
| MDP-23137 | Conglobatin C1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
