Arisugacin B | CAS No. | 182068-83-3 |
| Molecular Weight | 466.52 |
| Formula | C27H30O7 |
| SMILES | C[C@@]12[C@@]3([C@](OC4=C(C(OC(C5=CC=C(C=C5)OC)=C4)=O)C3)(CC[C@]1(C(C)(C=CC2=O)C)O)C)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22977 | Leustroducsin B | Inquiry |
|
| MDP-23227 | Pantolactone (Standard) | Inquiry |
|
| MDP-22363 | Dehydroabietic Acid (Standard) | Inquiry |
|
| MDP-22570 | 27-O-Demethylrapamycin | Inquiry |
|
| MDP-22020 | Leupeptin Ac-LL Hydrochloride | Inquiry |
|
| MDP-12287 | S-Pyruvylglutathione | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
