Aromadendrene | CAS No. | 489-39-4 |
| Synonyms | (+)-Aromadendrene |
| Molecular Weight | 204.35 |
| Formula | C15H24 |
| Appearance | Liquid (Density: 0.9166 g/cm3) |
| Color | Colorless to light yellow |
| SMILES | C=C1CC[C@]2([H])[C@](C2(C)C)([H])[C@]3([H])[C@H](C)CC[C@@]13[H] |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24238 | Cephaibol B | Inquiry |
|
| MDP-22200 | Ursodeoxycholic Acid (Standard) | Inquiry |
|
| MDP-22676 | Hypocrellin A (Standard) | Inquiry |
|
| MDP-23925 | Darlucin B | Inquiry |
|
| MDP-11517 | Gibberellin A1 | Inquiry |
|
| MDP-23429 | Argyrin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
