Ascr#7 | CAS No. | 1139837-37-8 |
| Purity | 98.37% |
| Molecular Weight | 274.31 |
| Formula | C13H22O6 |
| Appearance | Viscous Liquid |
| Color | Colorless to light yellow |
| SMILES | OC(/C=C/CC[C@@H](C)O[C@H]1[C@@H](C[C@H]([C@@H](O1)C)O)O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| ADP-10837 | DL-Laudanosine (Standard) | Inquiry |
|
| ADP-10525 | Resibufagin | Inquiry |
|
| ADP-10581 | Hirudonucleodisulfide B | Inquiry |
|
| ADP-10469 | 3-Pentanol | Inquiry |
|
| ADP-10871 | Acetylaranotin | Inquiry |
|
| ADP-10513 | (9Z,11E)-Prodlure | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
