Asperuloside (Standard) | CAS | 14259-45-1 |
| Molecular Weight | 414.36 |
| Formula | C18H22O11 |
| SMILES | O=C1O[C@]2([H])[C@@]3([H])[C@](C(COC(C)=O)=C2)([H])[C@H](O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)OC=C13 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18462 | Raddeanoside 20 | Inquiry |
|
| PDP-15609 | Laetanine | Inquiry |
|
| PDP-14119 | 5,7-Dihydroxycoumarin | Inquiry |
|
| PDP-13430 | Neohesperidin | Inquiry |
|
| PDP-16876 | Isocudraniaxanthone B | Inquiry |
|
| PDP-19860 | Cycloastragenol (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
