Azadirachtin | Appearance | Solid |
| CAS | 11141-17-6 |
| Purity | 99.06% |
| Molecular Weight | 720.71 |
| Formula | C35H44O16 |
| Color | White to light yellow |
| SMILES | C[C@@]1([C@@]([C@@]2(O)C(OC)=O)([H])[C@]([C@H](C[C@H]3OC(C)=O)OC(/C(C)=C/C)=O)(CO2)[C@@]4([H])[C@](OC[C@@]43C(OC)=O)([H])[C@H]1O)[C@]([C@@H](O[C@]5([H])OC=C6)C[C@H]7[C@]56O)(O8)[C@]78C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17725 | Aquilarone B | Inquiry |
|
| PDP-14815 | Ginsenoside Rh3 | Inquiry |
|
| PDP-13540 | N-trans-Caffeoyltyramine | Inquiry |
|
| PDP-16756 | Anemarrhenasaponin I | Inquiry |
|
| PDP-19731 | Cyasterone (Standard) | Inquiry |
|
| PDP-13280 | Farnesol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
