Azedarachol | CAS | 99305-11-0 |
| Molecular Weight | 420.58 |
| Formula | C25H40O5 |
| SMILES | C[C@@H](OC(C(C)=C)=O)[C@H]1[C@@H](O)C[C@@]2([H])[C@]3([H])CC[C@@]4([H])C[C@H](O)[C@H](O)C[C@]4(C)[C@@]3([H])CC[C@]12C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16626 | Chrysanthemic Acid | Inquiry |
|
| PDP-17719 | Schiarisanrin E | Inquiry |
|
| PDP-15185 | Schisantherin B | Inquiry |
|
| PDP-13136 | Rutin | Inquiry |
|
| PDP-17938 | 1-Hydroxy-2-methylanthraquinone | Inquiry |
|
| PDP-15059 | 9,10-Dihydroxystearic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
