Bagougeramine B | CAS No. | 104840-34-8 |
| Molecular Weight | 612.68 |
| Formula | C24H44N12O7 |
| SMILES | O[C@H]1[C@H](N2C(N=C(C=C2)N)=O)O[C@@H]([C@H]([C@@H]1O)NC([C@@H](CNC(N)=N)NC(CNC)=O)=O)C(NCCCNCCCCN)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-21951 | Penicisteck Acid F | Inquiry |
|
| MDP-23373 | Propionylglycine (Standard) | Inquiry |
|
| MDP-23884 | Fluopsin F | Inquiry |
|
| MDP-23038 | Tetromycin C5 | Inquiry |
|
| MDP-23258 | Panepophenanthrin | Inquiry |
|
| MDP-23808 | Mycoplanecin D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
