Benzophenone (Standard) | CAS No. | 119-61-9 |
| Molecular Weight | 182.22 |
| Formula | C13H10O |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C(C1=CC=CC=C1)C2=CC=CC=C2 |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24327 | Matlystatin B | Inquiry |
|
| MDP-22369 | 3-Hydroxyhexadecanoic Acid | Inquiry |
|
| MDP-23293 | Josamycin (Standard) | Inquiry |
|
| MDP-23969 | Furaquinocin B | Inquiry |
|
| MDP-24059 | 3-Hydroxyrifamycin S | Inquiry |
|
| MDP-11121 | Fumaric Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.