Bidenoside C | CAS | 700877-55-0 |
| Molecular Weight | 310.34 |
| Formula | C16H22O6 |
| SMILES | C/C=C\C#CC#CCCCO[C@@H]1O[C@@H]([C@H]([C@@H]([C@H]1O)O)O)CO |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13021 | Citrus Aurantium Extract, 90%, 95% | Inquiry |
|
| PDP-16516 | Xanthone (Standard) | Inquiry |
|
| PDP-13634 | Safranal | Inquiry |
|
| PDP-17998 | Rehmapicroside | Inquiry |
|
| PDP-18139 | Neochamaejasmin B | Inquiry |
|
| PDP-13878 | (-)-Catechin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
