Biocytin (Standard) | CAS No. | 576-19-2 |
| Synonyms | (+)-Biocytin (Standard) |
| Molecular Weight | 372.48 |
| Formula | C16H28N4O4S |
| SMILES | N[C@@H](CCCCNC(CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O)=O)C(O)=O |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11769 | Methyl Cholate | Inquiry |
|
| MDP-23742 | Griseolutein B | Inquiry |
|
| MDP-12601 | Asperaculane B | Inquiry |
|
| MDP-12206 | Ambuic Acid | Inquiry |
|
| MDP-23677 | Myceliothermophin E | Inquiry |
|
| MDP-11109 | Caffeic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
