Bisabolol Oxide A | Appearance | Liquid (Density: 0.982±0.06 g/cm3) |
| CAS | 22567-36-8 |
| Purity | 99.66% |
| Molecular Weight | 238.37 |
| Formula | C15H26O2 |
| Color | Colorless to light yellow |
| SMILES | C[C@@]1(OC(C)([C@H](CC1)O)C)[C@@]2([H])CCC(C)=CC2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15530 | Crocetin Dialdehyde | Inquiry |
|
| PDP-20085 | Jasminoside | Inquiry |
|
| PDP-18510 | Moscatin | Inquiry |
|
| PDP-19199 | Cucurbitacin C | Inquiry |
|
| PDP-15196 | Isoprocurcumenol | Inquiry |
|
| PDP-17762 | Juniper Camphor | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
