Blumenol B | CAS | 36151-01-6 |
| Molecular Weight | 226.31 |
| Formula | C13H22O3 |
| SMILES | C[C@@H](O)CC[C@@]1(C(C)(CC(C=C1C)=O)C)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16516 | Xanthone (Standard) | Inquiry |
|
| PDP-15488 | Gibberellin A5 | Inquiry |
|
| PDP-19312 | Hosenkoside B | Inquiry |
|
| PDP-13888 | Scopolamine Hydrobromide Trihydrate | Inquiry |
|
| PDP-16504 | (E)-Ethyl Cinnamate | Inquiry |
|
| PDP-15752 | 8-Geranyloxypsoralen | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
