Boeravinone B | Appearance | Solid |
| CAS | 114567-34-9 |
| Molecular Weight | 312.27 |
| Formula | C17H12O6 |
| Color | Light yellow to yellow |
| SMILES | O=C1C2=C(C(O)OC3=CC=CC=C32)OC4=CC(O)=C(C)C(O)=C14 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18659 | Rabdosin C | Inquiry |
|
| PDP-15484 | Britannilactone | Inquiry |
|
| PDP-16386 | Tenacissoside A | Inquiry |
|
| PDP-19884 | L-Perillaldehyde (Standard) | Inquiry |
|
| PDP-20031 | O-Nornuciferine | Inquiry |
|
| PDP-16526 | Nagilactone B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
