Boeravinone B (Standard) | CAS | 114567-34-9 |
| Molecular Weight | 312.27 |
| Formula | C17H12O6 |
| SMILES | O=C1C2=C(C(O)OC3=CC=CC=C32)OC4=CC(O)=C(C)C(O)=C14 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19437 | Podocarpusflavone B | Inquiry |
|
| PDP-19426 | Ptelatoside B | Inquiry |
|
| PDP-16172 | Mogroside II-A | Inquiry |
|
| PDP-15984 | (+)-Epicatechin | Inquiry |
|
| PDP-15717 | Acetylcorynoline | Inquiry |
|
| PDP-14796 | Alismoxide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
