Brassinin | Synonyms | Brassinine |
| Appearance | Solid |
| CAS | 105748-59-2 |
| Purity | 99.74% |
| Molecular Weight | 236.36 |
| Formula | C11H12N2S2 |
| Color | Off-white to light yellow |
| SMILES | S=C(NCC1=CNC2=CC=CC=C21)SC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16404 | (+)-Secoisolariciresinol | Inquiry |
|
| PDP-13255 | Forsythiaside A | Inquiry |
|
| PDP-19674 | Isoxanthohumol (Standard) | Inquiry |
|
| PDP-17983 | Fallaxsaponin A | Inquiry |
|
| PDP-19477 | Paeonicluside | Inquiry |
|
| PDP-17499 | Huzhangoside C | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
