Cabenoside D | CAS | 88901-40-0 |
| Molecular Weight | 636.86 |
| Formula | C36H60O9 |
| SMILES | C[C@]12[C@](CC=C3[C@@]2([H])CC[C@@H](C3(C)C)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)([H])[C@]5([C@](CC1=O)([C@@](CC5)([H])[C@H](C)CC[C@@H](O)C(C)(O)C)C)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18003 | Myricetin 3-O-(3"-O-galloyl)-α-L-rhamnopyranoside | Inquiry |
|
| PDP-13644 | Cephaeline | Inquiry |
|
| PDP-16715 | Blumeatin B | Inquiry |
|
| PDP-17177 | Eriobofuran | Inquiry |
|
| PDP-14279 | Vitamin U Chloride | Inquiry |
|
| PDP-19948 | Iriflophenone 3-C-glucoside (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
