Calceolarioside B (Standard) | CAS | 105471-98-5 |
| Molecular Weight | 478.45 |
| Formula | C23H26O11 |
| SMILES | O[C@H]([C@@H](O)[C@@H]1O)[C@@H](O[C@@H]1COC(/C=C/C2=CC(O)=C(O)C=C2)=O)OCCC3=CC(O)=C(O)C=C3 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17233 | Stigmane B | Inquiry |
|
| PDP-18501 | Eriosematin | Inquiry |
|
| PDP-15151 | Polydatin (Standard) | Inquiry |
|
| PDP-13452 | Theaflavin | Inquiry |
|
| PDP-14637 | (-)-Sparteine | Inquiry |
|
| PDP-15064 | Tetrahydroxymethoxychalcone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
