Camelliaside A (Standard) | CAS | 135095-52-2 |
| Molecular Weight | 756.66 |
| Formula | C33H40O20 |
| SMILES | O=C1C(O[C@H]2[C@@H]([C@H]([C@H](O)[C@@H](CO[C@H]3[C@@H]([C@@H]([C@@H](O)[C@H](C)O3)O)O)O2)O)O[C@]4([H])O[C@@H]([C@H](O)[C@H](O)[C@H]4O)CO)=C(C5=CC=C(O)C=C5)OC6=CC(O)=CC(O)=C61 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16398 | 15-Acetyl-deoxynivalenol | Inquiry |
|
| PDP-19841 | Robinetin (Standard) | Inquiry |
|
| PDP-13758 | 7,4'-Dihydroxyflavone | Inquiry |
|
| PDP-17865 | Limocitrin 3,7-diglucoside | Inquiry |
|
| PDP-18571 | Cratoxylone | Inquiry |
|
| PDP-16715 | Blumeatin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.