Camelliaside B (Standard) | CAS | 131573-90-5 |
| Molecular Weight | 726.63 |
| Formula | C32H38O19 |
| SMILES | O=C1C(O[C@H]2[C@@H]([C@H]([C@H](O)[C@@H](CO[C@H]3[C@@H]([C@@H]([C@@H](O)[C@H](C)O3)O)O)O2)O)O[C@@]4([H])[C@@H]([C@H]([C@H](O)CO4)O)O)=C(C5=CC=C(O)C=C5)OC6=CC(O)=CC(O)=C61 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14169 | (R)-(+)-Citronellal | Inquiry |
|
| PDP-18376 | Farrerol 7-O-β-D-glucopyranoside | Inquiry |
|
| PDP-17158 | Poststerone | Inquiry |
|
| PDP-15333 | Zinc Phytate | Inquiry |
|
| PDP-18208 | Longikaurin E | Inquiry |
|
| PDP-13245 | Lycorine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
