Capoamycin | CAS No. | 97937-29-6 |
| Molecular Weight | 618.67 |
| Formula | C35H38O10 |
| SMILES | CCCCC/C=C/C=C/C(OC1C(OC(CC1O)C2=CC=C(C(C3=C4C=CC5(C3(C(C=C(C5)C)=O)O)O)=O)C(C4=O)=C2O)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11057 | Polymyxin B Sulfate | Inquiry |
|
| MDP-22841 | Pinusolidic Acid | Inquiry |
|
| MDP-11388 | Naringinase | Inquiry |
|
| MDP-11680 | Moniliformin Sodium Salt | Inquiry |
|
| MDP-12692 | Alterbrassicene B | Inquiry |
|
| MDP-21973 | Lanosta-7,9(11),24-trien-3α-hydroxy-26-oic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
