Capsaicin | Synonyms | (E)-Capsaicin |
| Appearance | Solid |
| CAS | 404-86-4 |
| Purity | 99.88% |
| Molecular Weight | 305.41 |
| Formula | C18H27NO3 |
| Color | White to off-white |
| SMILES | CC(C)/C=C/CCCCC(NCC1=CC=C(O)C(OC)=C1)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 1 year; -20°C, 6 months (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15373 | ArnicolideC | Inquiry |
|
| PDP-19101 | Cathayanon H | Inquiry |
|
| PDP-15818 | Cyperotundone | Inquiry |
|
| PDP-15069 | Heneicosane | Inquiry |
|
| PDP-20487 | Columbianadin (Standard) | Inquiry |
|
| PDP-14880 | Falcarinol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
