Carasinol D | CAS | 1072797-66-0 |
| Molecular Weight | 922.92 |
| Formula | C56H42O13 |
| SMILES | O=C(C(C=C1)=CC=C1O)[C@@H]2C3=C([C@@](C(C=C4O)=C(C5=C4)[C@@]([C@@](C(C=C6)=CC=C6O)([H])O5)([H])C7=CC(O)=C8)([H])[C@@](C(C=C9)=CC=C9O)([H])C7=C8O)C(O)=CC(O)=C3[C@@](C(C=C%10)=CC=C%10O)([H])[C@@]2([H])C%11=CC(O)=CC(O)=C%11 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13892 | 1F-Fructofuranosylnystose | Inquiry |
|
| PDP-14794 | 1,4-Dicaffeoylquinic Acid | Inquiry |
|
| PDP-19017 | Narchinol B | Inquiry |
|
| PDP-13368 | Lupeol | Inquiry |
|
| PDP-14907 | Microhelenin C | Inquiry |
|
| PDP-19077 | 1,2,3-Tri-O-methyl-7,8-methyleneflavellagic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
