Carnemycin B | CAS No. | 1391935-53-7 |
| Molecular Weight | 452.49 |
| Formula | C23H32O9 |
| SMILES | OC1=C([C@@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO)C(O)=CC(CC/C=C/C=C/CCC)=C1C(OC)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11590 | Hexadecanedioic Acid | Inquiry |
|
| MDP-23730 | Scyphostatin | Inquiry |
|
| MDP-11109 | Caffeic Acid | Inquiry |
|
| MDP-22173 | Longestin | Inquiry |
|
| MDP-23868 | Kistamicin B | Inquiry |
|
| MDP-23137 | Conglobatin C1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
