α-Carotene (Standard) | CAS No. | 7488-99-5 |
| Molecular Weight | 536.87 |
| Formula | C40H56 |
| SMILES | CC1(C)[C@@H](/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)C(C)=CCC1 |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-21873 | Ophiobolin B | Inquiry |
|
| MDP-12616 | Dendryphiellin D | Inquiry |
|
| MDP-12486 | A2315A | Inquiry |
|
| MDP-12245 | Taurine (Standard) | Inquiry |
|
| MDP-23884 | Fluopsin F | Inquiry |
|
| MDP-22358 | Tobramycin (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
