Carpinontriol B | CAS | 473451-73-9 |
| Molecular Weight | 344.36 |
| Formula | C19H20O6 |
| SMILES | O=C([C@H](O)[C@@H](O)[C@@H](O)C1)CCC2=CC(C3=CC1=CC=C3O)=C(O)C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18419 | Iriflophenone 2-O-α-rhamnoside | Inquiry |
|
| PDP-17290 | (E/Z)-Xanthohumol | Inquiry |
|
| PDP-20169 | Alisol C 23-acetate (Standard) | Inquiry |
|
| PDP-14246 | Kahweol | Inquiry |
|
| PDP-18687 | Taxezopidine G | Inquiry |
|
| PDP-19626 | (+)-Crinatusin A1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
