Cassiaside B2 | CAS | 218155-40-9 |
| Molecular Weight | 920.82 |
| Formula | C39H52O25 |
| SMILES | OC1=C(C(C=C(O2)C)=O)C2=CC3=C1C(O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O[C@@H]6O[C@@H]([C@H]([C@@H]([C@H]6O)O)O)CO[C@@H]7O[C@@H]([C@H]([C@@H]([C@H]7O)O)O)CO)O)=CC(OC)=C3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14948 | Pimpinellin | Inquiry |
|
| PDP-13405 | Schisandrin B | Inquiry |
|
| PDP-17806 | Triptonoterpene Me Ether | Inquiry |
|
| PDP-19891 | Parishin E (Standard) | Inquiry |
|
| PDP-15208 | N-Methylphenethylamine | Inquiry |
|
| PDP-17381 | Chisocheton Compound F | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
