Cephamycin B | CAS No. | 34279-77-1 |
| Molecular Weight | 579.58 |
| Formula | C25H29N3O11S |
| SMILES | OC([C@H](N)CCCC(N[C@]1([C@]2([H])N(C(C(O)=O)=C(CS2)COC(/C(OC)=C/C3=CC=C(C=C3)O)=O)C1=O)OC)=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24193 | Empedopeptin | Inquiry |
|
| MDP-11940 | Benzothiazole | Inquiry |
|
| MDP-12427 | Oct-1-en-3-ol (Standard) | Inquiry |
|
| MDP-22472 | (E)-Osmundacetone (Standard) | Inquiry |
|
| MDP-24321 | Epithienamycin F | Inquiry |
|
| MDP-12050 | Cyclosporin D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
