Cetoniacytone B | CAS No. | 496775-49-6 |
| Molecular Weight | 171.15 |
| Formula | C7H9NO4 |
| SMILES | OC[C@]12[C@]([C@H](C(N)=CC2=O)O)([H])O1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11410 | Avermectin B1 | Inquiry |
|
| MDP-12550 | Safracin B | Inquiry |
|
| MDP-11984 | Enterolactone | Inquiry |
|
| MDP-11087 | Xanthurenic Acid | Inquiry |
|
| MDP-23652 | (-)-3-Dehydroshikimic Acid (Standard) | Inquiry |
|
| MDP-21919 | Dihydroprehelminthosporol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.