Chaetoglobosin Vb | CAS No. | 1399690-75-5 |
| Molecular Weight | 528.64 |
| Formula | C32H36N2O5 |
| SMILES | O=C1N[C@@H](CC2=CNC3=C2C=CC=C3)[C@]4([H])C(C)=C(C)[C@@H](O)[C@@](/C=C/C[C@H](C)[C@]5([H])[C@@](C(C(O)=C5C)=O)([H])C6)([H])[C@]14C6=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23188 | Myrothecine A | Inquiry |
|
| MDP-23907 | Curromycin B | Inquiry |
|
| MDP-23236 | 2-Acetylfuran (Standard) | Inquiry |
|
| MDP-12292 | 5-Methyltetrahydrofolic Acid (Standard) | Inquiry |
|
| MDP-23972 | Fusacandin B | Inquiry |
|
| MDP-22559 | Mitomycin Z | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
