Chartarlactam A | CAS No. | 1528745-88-1 |
| Molecular Weight | 399.48 |
| Formula | C23H29NO5 |
| SMILES | C[C@@]12[C@@]3([C@@H](CC[C@@]1([H])C(C)([C@@H](CC2)O)C)C)OC4=C(C(NC5=O)=O)C5=CC(O)=C4C3 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22794 | DL-Pantolactone (Standard) | Inquiry |
|
| MDP-11403 | Oxytetracycline | Inquiry |
|
| MDP-24207 | Purpactin B | Inquiry |
|
| MDP-22170 | Acetamide (Standard) | Inquiry |
|
| MDP-22978 | Leustroducsin C | Inquiry |
|
| MDP-12097 | Tubulysin M | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
