Chimeramycin B | CAS No. | 87092-83-9 |
| Molecular Weight | 869.13 |
| Formula | C46H80N2O13 |
| SMILES | C[C@H]1OC(CC[C@@H]1N(C)C)O[C@@H](/C=C/C(C)=C/[C@H]([C@H](O2)CC)C)[C@@H](C[C@H]([C@@H]([C@H]([C@@H](CC2=O)O)C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C)O[C@@H]4O[C@H]([C@@H]([C@](O)(C4)C)O)C)N(C)C)O)CC=O)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11346 | Dehydrocholic Acid | Inquiry |
|
| MDP-22830 | Cryptosporioptide A | Inquiry |
|
| MDP-24153 | Fibrostatin B | Inquiry |
|
| MDP-23546 | Hericenone A | Inquiry |
|
| MDP-23741 | Griseolutein A | Inquiry |
|
| MDP-22624 | Aminoadipic Acid (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
