Chloramphenicol Succinate | CAS No. | 3544-94-3 |
| Molecular Weight | 423.20 |
| Formula | C15H16Cl2N2O8 |
| SMILES | O=C(OC[C@@H](NC(C(Cl)Cl)=O)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1)CCC(O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23860 | Cyclacidin | Inquiry |
|
| MDP-23739 | Platenomycin C3 | Inquiry |
|
| MDP-22244 | IT-143A | Inquiry |
|
| MDP-12038 | Lupanine | Inquiry |
|
| MDP-22054 | Aclacinomycin A (Standard) | Inquiry |
|
| MDP-23796 | Napsamycin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
