Chlortetracycline Hydrochloride | CAS No. | 64-72-2 |
| Synonyms | 7-Chlorotetracycline Hydrochloride |
| Molecular Weight | 515.34 |
| Formula | C22H24Cl2N2O8 |
| Appearance | Solid |
| Color | Light yellow to yellow |
| SMILES | O=C(C(C1=O)=C(O)[C@@H](N(C)C)[C@]2([H])C[C@]3([H])[C@](C)(O)C4=C(C(C3=C(O)[C@@]21O)=O)C(O)=CC=C4Cl)N.[H]Cl |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23692 | Salfredin A7 | Inquiry |
|
| MDP-10921 | Puromycin Dihydrochloride | Inquiry |
|
| MDP-11540 | 3-Indoleacetonitrile | Inquiry |
|
| MDP-22976 | Nannochelin B | Inquiry |
|
| MDP-24209 | Liposidomycin B | Inquiry |
|
| MDP-11291 | Xanthosine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
