Chrodrimanin B | CAS No. | 132196-54-4 |
| Molecular Weight | 484.54 |
| Formula | C27H32O8 |
| SMILES | C[C@@]([C@@](C(C)1C)([H])C[C@@H]2O)(C=CC1=O)[C@@](CC3=C([C@H]([C@H]4C)OC(C)=O)C(C(O4)=O)=C5O)([H])[C@]2(OC3=C5)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23520 | Auramycin B | Inquiry |
|
| MDP-22039 | α,α-Trehalose 6-phosphate | Inquiry |
|
| MDP-11480 | Spiramycin | Inquiry |
|
| MDP-10913 | Lipopolysaccharides, From E. Coli O55:B5 | Inquiry |
|
| MDP-11871 | D-Arabinose, Purity: 99.94% | Inquiry |
|
| MDP-23488 | Arohynapene A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
