Chrysospermin B | CAS No. | 160791-54-8 |
| Molecular Weight | 1900.22 |
| Formula | C90H142N22O23 |
| SMILES | O=C(N)CC[C@@H](C(N[C@@H](CC1=CNC2=C1C=CC=C2)CO)=O)NC(C(C)(C)NC(C(C)(C)NC(C(C)(C)NC([C@@](C)(CC)NC(C(C)(C)NC([C@H](C)NC([C@H](C)NC(C(C)(C)NC(C(C)(C)NC(CNC([C@H](CCC(N)=O)NC([C@H](CC(C)C)NC(C(C)(C)NC(C(C)(C)NC([C@H](CO)NC(C(C)(C)NC([C@H](CC3=CC=CC=C3)NC(C)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11035 | Ellagic Acid | Inquiry |
|
| MDP-23543 | Celesticetin B | Inquiry |
|
| MDP-22053 | Imipenem Monohydrate (Standard) | Inquiry |
|
| MDP-11534 | Docosapentaenoic Acid (22n-3) | Inquiry |
|
| MDP-23716 | Gerfelin | Inquiry |
|
| MDP-23774 | Cerexin B1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
