Cinnatriacetin B | CAS No. | 244277-15-4 |
| Molecular Weight | 376.40 |
| Formula | C23H20O5 |
| SMILES | OC(CCC/C=C\CC#CC#CC#CCOC(/C=C\C1=CC=C(C=C1)O)=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-10973 | Chenodeoxycholic Acid | Inquiry |
|
| MDP-11484 | 7α-Hydroxy-4-cholesten-3-one | Inquiry |
|
| MDP-23022 | Tetracycline (Standard) | Inquiry |
|
| MDP-23796 | Napsamycin B | Inquiry |
|
| MDP-11921 | 2-Carboxybenzaldehyde | Inquiry |
|
| MDP-23538 | Badione A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
